2-(Trifluoromethyl)benzo[d]thiazol-6-ol, 97%
cas: 1261740-05-9 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)benzo[d]thiazol-6-ol, 97% (CAS 1261740-05-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A406926-250mg |
| cas | 1261740-05-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1427.25 Pln | |
| Ambeed | 5g | 5777.12 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 635.60 Pln | |
| Chemat | 1g | 1494.80 Pln | |
| Chemat | 5g | 5786.00 Pln | |
| Fluorochem | 100mg | 804.94 Pln | |
| Fluorochem | 250mg | 1169.40 Pln | |
| Fluorochem | 1g | 2778.21 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 636.47 Pln | |
| BLDpharm | 1g | 1530.60 Pln | |
| BLDpharm | 5g | 6223.39 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(trifluoromethyl)-1,3-benzothiazol-6-ol (CAS 1261740-05-9) is a chemical compound with the molecular formula C8H4F3NOS and a molecular weight of 219.19 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-benzothiazol-6-ol. InChIKey: OUHJPZVFPZECGP-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NOS |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-benzothiazol-6-ol |
| InChIKey | OUHJPZVFPZECGP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)SC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)