CAS 217095-69-7 is the registry number for 7-(Trifluoromethyl)benzo[d]oxazole-2(3H)-thione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione (CAS 217095-69-7) is a chemical compound with the molecular formula C8H4F3NOS and a molecular weight of 219.19 g/mol. IUPAC name: 7-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione. InChIKey: WDNLWVMLRDZEKY-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NOS |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione |
| InChIKey | WDNLWVMLRDZEKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=S)O2)C(F)(F)F |
Computed by PubChem (NCBI)