CAS 24032-84-6 appears in our catalog under these names: 4-(Trifluoromethylthio)phenyl isocyanate, 95%, 1-Isocyanato-4-((Trifluoromethyl)Thio)-Benzene, 4-(Trifluoromethylthio)phenyl isocyanate 95%, 4-(Trifluoromethylthio)phenyl isocyanate, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 2g, 5g, 10g, 25g, 100mg.
1-isocyanato-4-(trifluoromethylsulfanyl)benzene (CAS 24032-84-6) is a chemical compound with the molecular formula C8H4F3NOS and a molecular weight of 219.19 g/mol. IUPAC name: 1-isocyanato-4-(trifluoromethylsulfanyl)benzene. InChIKey: NYQSIHZNEJCZKX-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NOS |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 1-isocyanato-4-(trifluoromethylsulfanyl)benzene |
| InChIKey | NYQSIHZNEJCZKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=O)SC(F)(F)F |
Computed by PubChem (NCBI)