CAS 175203-89-1 appears in our catalog under these names: 3-(Thiophen-2-yl)-5-(trifluoromethyl)isoxazole, 95+%, 3-[Thien-2-yl-5-(trifluoromethyl)]isoxazole. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 1g.
3-thiophen-2-yl-5-(trifluoromethyl)-1,2-oxazole (CAS 175203-89-1) is a chemical compound with the molecular formula C8H4F3NOS and a molecular weight of 219.19 g/mol. IUPAC name: 3-thiophen-2-yl-5-(trifluoromethyl)-1,2-oxazole. InChIKey: TUQUPXBKYCKHTB-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NOS |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 3-thiophen-2-yl-5-(trifluoromethyl)-1,2-oxazole |
| InChIKey | TUQUPXBKYCKHTB-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NOC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)