CAS 13451-80-4 appears in our catalog under these names: 2-Thio-5-(trifluoromethyl)-1,3-benzoxazole, 95%, 5-(Trifluoromethyl)benzo[d]oxazole-2(3H)-thione, 97%, 2-Thio-5-(trifluoromethyl)-1,3-benzoxazole, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 100mg, on request, 250mg, 1g.
5-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione (CAS 13451-80-4) is a chemical compound with the molecular formula C8H4F3NOS and a molecular weight of 219.19 g/mol. IUPAC name: 5-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione. InChIKey: MBQRNNRGEFJOFN-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NOS |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 5-(trifluoromethyl)-3H-1,3-benzoxazole-2-thione |
| InChIKey | MBQRNNRGEFJOFN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)NC(=S)O2 |
Computed by PubChem (NCBI)