2-(Trifluoromethyl)thiazole-5-carboxylic acid, 95%
cas: 1286734-84-6 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)thiazole-5-carboxylic acid, 95% (CAS 1286734-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A106112-100mg |
| cas | 1286734-84-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 25g | 2061.38 Pln | |
| BLDpharm | 100mg | 158.86 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 558.72 Pln | |
| BLDpharm | 25g | 2213.69 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1286734-84-6) is a chemical compound with the molecular formula C5H2F3NO2S and a molecular weight of 197.14 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: POPWMBOAMPURLZ-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO2S |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | POPWMBOAMPURLZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)