2-(Trifluoromethyl)Thiazole-5-Carboxylic Acid, 98%
cas: 1286734-84-6 — see every product listed under this CAS number, including other names
2-(Trifluoromethyl)Thiazole-5-Carboxylic Acid, 98% (CAS 1286734-84-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111YAA-100mg |
| cas | 1286734-84-6 |
| size | 100mg |
| availability | 30g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 10g | 654.80 Pln | |
| Chemat | 25g | 1446.80 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 539.41 Pln | |
| Fluorochem | 10g | 935.11 Pln | |
| Fluorochem | 25g | 2116.98 Pln | |
| Fluorochem | 50g | 4137.10 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1286734-84-6) is a chemical compound with the molecular formula C5H2F3NO2S and a molecular weight of 197.14 g/mol. IUPAC name: 2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: POPWMBOAMPURLZ-UHFFFAOYSA-N.
| Molecular formula | C5H2F3NO2S |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | POPWMBOAMPURLZ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)