cas: 20389-05-3 — see every product listed under this CAS number, including other names
2-(p-Tolyl)quinoline-4-carboxylic acid (CAS 20389-05-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11306W-50mg |
| cas | 20389-05-3 |
| size | 50mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 194.00 Pln | |
| Chemat | 200mg | 352.40 Pln |
| delivery time | 3 weeks |
|---|
2-(4-methylphenyl)quinoline-4-carboxylic acid (CAS 20389-05-3) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 2-(4-methylphenyl)quinoline-4-carboxylic acid. InChIKey: CKOMAFAOCHXEQX-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 2-(4-methylphenyl)quinoline-4-carboxylic acid |
| InChIKey | CKOMAFAOCHXEQX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O |
Computed by PubChem (NCBI)