Products 174636-96-5

CAS 174636-96-5 is the registry number for 5-Methyl-2-phenylquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-2-phenylquinoline-4-carboxylic acid (CAS 174636-96-5) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 5-methyl-2-phenylquinoline-4-carboxylic acid. InChIKey: XIIRDKOFVHVTQL-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO2
Molecular weight263.29 g/mol
IUPAC name5-methyl-2-phenylquinoline-4-carboxylic acid
InChIKeyXIIRDKOFVHVTQL-UHFFFAOYSA-N
SMILESCC1=C2C(=CC=C1)N=C(C=C2C(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)