cas: 16524-23-5 — see every product listed under this CAS number, including other names
2-(p-Tolylamino)benzoic acid, 95%+, 95%+ (CAS 16524-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112W26-100mg |
| cas | 16524-23-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 818.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-(4-methylanilino)benzoic acid (CAS 16524-23-5) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 2-(4-methylanilino)benzoic acid. InChIKey: DEFSEYPSVLNHBM-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2-(4-methylanilino)benzoic acid |
| InChIKey | DEFSEYPSVLNHBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)