CAS 33901-20-1 appears in our catalog under these names: N-Benzyl-4-hydroxybenzamide, 95%, N-Benzyl-4-hydroxybenzamide 95%, N-Benzyl-4-hydroxybenzamide, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
N-benzyl-4-hydroxybenzamide (CAS 33901-20-1) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: N-benzyl-4-hydroxybenzamide. InChIKey: FVQDRWUYZFPHLU-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | N-benzyl-4-hydroxybenzamide |
| InChIKey | FVQDRWUYZFPHLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)