CAS 720720-29-6 is the registry number for 2-(tert-Butyl) 6-methyl 1,3-dihydro-2H-pyrrolo[3,4-c]pyridine-2,6-dicarboxylate, 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-O-tert-butyl 6-O-methyl 1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxylate (CAS 720720-29-6) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl 1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxylate. InChIKey: LBARTVVGGGOKAT-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 2-O-tert-butyl 6-O-methyl 1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxylate |
| InChIKey | LBARTVVGGGOKAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=NC=C2C1)C(=O)OC |
Computed by PubChem (NCBI)