Products 720720-29-6

CAS 720720-29-6 is the registry number for 2-(tert-Butyl) 6-methyl 1,3-dihydro-2H-pyrrolo[3,4-c]pyridine-2,6-dicarboxylate, 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-O-tert-butyl 6-O-methyl 1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxylate (CAS 720720-29-6) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 2-O-tert-butyl 6-O-methyl 1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxylate. InChIKey: LBARTVVGGGOKAT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18N2O4
Molecular weight278.30 g/mol
IUPAC name2-O-tert-butyl 6-O-methyl 1,3-dihydropyrrolo[3,4-c]pyridine-2,6-dicarboxylate
InChIKeyLBARTVVGGGOKAT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2=CC(=NC=C2C1)C(=O)OC

Computed by PubChem (NCBI)