CAS 1152516-63-6 appears in our catalog under these names: 2-((2-Methylpropyl)sulfanyl)-5-nitrobenzoic acid, 2-[(2-Methylpropyl)sulfanyl]-5-nitrobenzoic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
2-(2-methylpropylsulfanyl)-5-nitrobenzoic acid (CAS 1152516-63-6) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 2-(2-methylpropylsulfanyl)-5-nitrobenzoic acid. InChIKey: NUYDWBFHNODZQP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-(2-methylpropylsulfanyl)-5-nitrobenzoic acid |
| InChIKey | NUYDWBFHNODZQP-UHFFFAOYSA-N |
| SMILES | CC(C)CSC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)