CAS 63170-37-6 is the registry number for 2-(1,1-Dioxido-1,2-thiazinan-2-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-(1,1-dioxothiazinan-2-yl)benzoic acid (CAS 63170-37-6) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 2-(1,1-dioxothiazinan-2-yl)benzoic acid. InChIKey: TWGHPFNNZIONQR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 2-(1,1-dioxothiazinan-2-yl)benzoic acid |
| InChIKey | TWGHPFNNZIONQR-UHFFFAOYSA-N |
| SMILES | C1CCS(=O)(=O)N(C1)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)