cas: 53039-62-6 — see every product listed under this CAS number, including other names
2-[(4-Methoxyphenyl)methyl]-1H-1,3-benzodiazole, 95%, 95% (CAS 53039-62-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120M2C-100mg |
| cas | 53039-62-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1562.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(4-methoxyphenyl)methyl]-1H-benzimidazole (CAS 53039-62-6) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methyl]-1H-benzimidazole. InChIKey: RRZBJTKIOFNONP-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methyl]-1H-benzimidazole |
| InChIKey | RRZBJTKIOFNONP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CC2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)