CAS 91702-98-6 appears in our catalog under these names: Racecadotril Impurity 12, 3-(Acetylthio)-2-benzylpropionic Acid, >95% (HPLC), 2–((Acetylthio)methyl)–3–phenylpropionic Acid, 2-[(Acetylthio)methyl]-3-phenylpropionic Acid, >98.0%(T), 2-[(Acetylthio)Methyl]-3-Phenylpropionic Acid, 97%, 97%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Chemat. Available pack sizes: on request, 500mg, 100g, 25g, 1g, 5g, 10g.
2-(acetylsulfanylmethyl)-3-phenylpropanoic acid (CAS 91702-98-6) is a chemical compound with the molecular formula C12H14O3S and a molecular weight of 238.30 g/mol. IUPAC name: 2-(acetylsulfanylmethyl)-3-phenylpropanoic acid. InChIKey: BCAAXVOKLXDSPD-UHFFFAOYSA-N.
| Molecular formula | C12H14O3S |
|---|---|
| Molecular weight | 238.30 g/mol |
| IUPAC name | 2-(acetylsulfanylmethyl)-3-phenylpropanoic acid |
| InChIKey | BCAAXVOKLXDSPD-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC(CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)