CAS 212757-10-3 is the registry number for rac-(1R,2S)-2-(Thiophene-2-carbonyl)cyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-(1R,2S)-2-(thiophene-2-carbonyl)cyclohexane-1-carboxylic acid (CAS 212757-10-3) is a chemical compound with the molecular formula C12H14O3S and a molecular weight of 238.30 g/mol. IUPAC name: cis-(1R,2S)-2-(thiophene-2-carbonyl)cyclohexane-1-carboxylic acid. InChIKey: OHEBPHKWGCMUNK-DTWKUNHWSA-N.
| Molecular formula | C12H14O3S |
|---|---|
| Molecular weight | 238.30 g/mol |
| IUPAC name | cis-(1R,2S)-2-(thiophene-2-carbonyl)cyclohexane-1-carboxylic acid |
| InChIKey | OHEBPHKWGCMUNK-DTWKUNHWSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)C2=CC=CS2)C(=O)O |
Computed by PubChem (NCBI)