cas: 186431-96-9 — see every product listed under this CAS number, including other names
2-[(TERT-BUTOXYCARBONYL)AMINO]-3-(2-FLUOROPHENYL)PROPANOIC ACID, 98%, 98% (CAS 186431-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AS0S-100mg |
| cas | 186431-96-9 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 280.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 186431-96-9) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: 3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NTWUXBKUDXGMHV-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NTWUXBKUDXGMHV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=CC=C1F)C(=O)O |
Computed by PubChem (NCBI)