2-[4-(Fluorosulfonyl)phenyl]acetic acid, 95%
cas: 402-57-3 — see every product listed under this CAS number, including other names
2-[4-(Fluorosulfonyl)phenyl]acetic acid, 95% (CAS 402-57-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A853948-100mg |
| cas | 402-57-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 804.25 Pln | |
| Ambeed | 250mg | 1321.56 Pln | |
| Ambeed | 1g | 3274.00 Pln | |
| BLDpharm | 100mg | 786.41 Pln | |
| BLDpharm | 250mg | 1297.35 Pln | |
| BLDpharm | 1g | 2735.73 Pln | |
| Chemat | 250mg | 947.60 Pln | |
| Chemat | 1g | 2445.20 Pln | |
| Fluorochem | 250mg | 1742.11 Pln | |
| Fluorochem | 1g | 4527.59 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-fluorosulfonylphenyl)acetic acid (CAS 402-57-3) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 2-(4-fluorosulfonylphenyl)acetic acid. InChIKey: VARMWPGASRMINF-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-(4-fluorosulfonylphenyl)acetic acid |
| InChIKey | VARMWPGASRMINF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)S(=O)(=O)F |
Computed by PubChem (NCBI)