CAS 247569-56-8 appears in our catalog under these names: 2-Fluoro-5-(methylsulfonyl)benzoic Acid, 2–fluoro–5–methylsulfonylbenzoic acid, 2-Fluoro-5-methanesulfonylbenzoic acid, 2-Fluoro-5-(methylsulfonyl)benzoic acid 98%, 2-fluoro-5-methylsulfonylbenzoic acid, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g, 10g.
2-fluoro-5-methylsulfonylbenzoic acid (CAS 247569-56-8) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 2-fluoro-5-methylsulfonylbenzoic acid. InChIKey: ACBAHAXPEQHVHO-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-fluoro-5-methylsulfonylbenzoic acid |
| InChIKey | ACBAHAXPEQHVHO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)