Products 1895571-85-3
CAS 1895571-85-3 is the registry number for 2-Fluoro-6-(methylsulfonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoro-6-methylsulfonylbenzoic acid (CAS 1895571-85-3) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 2-fluoro-6-methylsulfonylbenzoic acid. InChIKey: POFGVAQRXNRTTN-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2-fluoro-6-methylsulfonylbenzoic acid |
| InChIKey | POFGVAQRXNRTTN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Fluoro-6-(methylsulfonyl)benzoic acid