Products 1368844-00-1
CAS 1368844-00-1 appears in our catalog under these names: 2,3-Dihydro-1,4-benzodioxin-6-sulfonyl f, 2,3-dihydro-1,4-benzodioxine-6-sulfonyl fluoride, >95%. Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 1G, 100mg, 250mg.
2,3-dihydro-1,4-benzodioxine-6-sulfonyl fluoride (CAS 1368844-00-1) is a chemical compound with the molecular formula C8H7FO4S and a molecular weight of 218.20 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-6-sulfonyl fluoride. InChIKey: CZDKQRQGVWYYKX-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4S |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-6-sulfonyl fluoride |
| InChIKey | CZDKQRQGVWYYKX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)F |
Computed by PubChem (NCBI)