2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol sulfuric acid, 99%
cas: 747-36-4 — see every product listed under this CAS number, including other names
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol sulfuric acid, 99% (CAS 747-36-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 250mg, 1g, 5g, 10g, 15g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1160P4-1mg |
| cas | 747-36-4 |
| size | 1mg |
| availability | 2500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 15g | 256.40 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 50g | 525.20 Pln | |
| Chemat | 75g | 750.80 Pln | |
| Chemat | 100g | 827.60 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid (CAS 747-36-4) is a chemical compound with the molecular formula C18H28ClN3O5S and a molecular weight of 434.0 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid. InChIKey: JCBIVZZPXRZKTI-UHFFFAOYSA-N.
| Molecular formula | C18H28ClN3O5S |
|---|---|
| Molecular weight | 434.0 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |
| InChIKey | JCBIVZZPXRZKTI-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
Computed by PubChem (NCBI)