Hydroxychloroquine sulfate 99%
cas: 747-36-4 — see every product listed under this CAS number, including other names
Hydroxychloroquine sulfate 99% (CAS 747-36-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105779-50mg |
| cas | 747-36-4 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 125.62 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 248.00 Pln | |
| Ambeed | 10g | 286.94 Pln | |
| Ambeed | 25g | 570.62 Pln | |
| Ambeed | 100g | 2072.50 Pln | |
| Ambeed | 500g | 4330.88 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105779 |
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid (CAS 747-36-4) is a chemical compound with the molecular formula C18H28ClN3O5S and a molecular weight of 434.0 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid. InChIKey: JCBIVZZPXRZKTI-UHFFFAOYSA-N.
| Molecular formula | C18H28ClN3O5S |
|---|---|
| Molecular weight | 434.0 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |
| InChIKey | JCBIVZZPXRZKTI-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
Computed by PubChem (NCBI)