cas: 132895-42-2 — see every product listed under this CAS number, including other names
2-{(5-(4-methylphenyl)-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid, 95% (CAS 132895-42-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A844916-10g |
| cas | 132895-42-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 132895-42-2) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: VIDPPAQOCSVKGA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | VIDPPAQOCSVKGA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NN2)SCC(=O)O |
Computed by PubChem (NCBI)