Products 50968-81-5
CAS 50968-81-5 appears in our catalog under these names: 1-Methyl-2-([(2-nitrophenyl)methyl]sulfanyl)-1h-imidazole, 95%, 1-Methyl-2-{((2-nitrophenyl)methyl)sulfanyl}-1H-imidazole, 95%, 1-Methyl-2-{((2-nitrophenyl)methyl)sulfanyl}-1H-imidazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-methyl-2-[(2-nitrophenyl)methylsulfanyl]imidazole (CAS 50968-81-5) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: 1-methyl-2-[(2-nitrophenyl)methylsulfanyl]imidazole. InChIKey: JQMTWRNGPMWTHO-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 1-methyl-2-[(2-nitrophenyl)methylsulfanyl]imidazole |
| InChIKey | JQMTWRNGPMWTHO-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1SCC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)