Products 1094373-30-4

CAS 1094373-30-4 is the registry number for 5-Methyl-1-[4-(methylthio)phenyl]-1h-1,2,3-triazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

5-methyl-1-(4-methylsulfanylphenyl)triazole-4-carboxylic acid (CAS 1094373-30-4) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: 5-methyl-1-(4-methylsulfanylphenyl)triazole-4-carboxylic acid. InChIKey: XVGNLMCAHAMCFY-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11N3O2S
Molecular weight249.29 g/mol
IUPAC name5-methyl-1-(4-methylsulfanylphenyl)triazole-4-carboxylic acid
InChIKeyXVGNLMCAHAMCFY-UHFFFAOYSA-N
SMILESCC1=C(N=NN1C2=CC=C(C=C2)SC)C(=O)O

Computed by PubChem (NCBI)