CAS 13807-17-5 is the registry number for Methyl 4-amino-2-(phenylamino)thiazole-5-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-2-anilino-1,3-thiazole-5-carboxylate (CAS 13807-17-5) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: methyl 4-amino-2-anilino-1,3-thiazole-5-carboxylate. InChIKey: JIFKUQJTZMOTRV-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | methyl 4-amino-2-anilino-1,3-thiazole-5-carboxylate |
| InChIKey | JIFKUQJTZMOTRV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(S1)NC2=CC=CC=C2)N |
Computed by PubChem (NCBI)