CAS 132895-42-2 appears in our catalog under these names: 2-([5-(4-Methylphenyl)-4h-1,2,4-triazol-3-yl]sulfanyl)acetic acid, 95%, 2-{(5-(4-methylphenyl)-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid, 95%, 2-{(5-(4-Methylphenyl)-4H-1,2,4-triazol-3-yl)sulfanyl}acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (CAS 132895-42-2) is a chemical compound with the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. IUPAC name: 2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid. InChIKey: VIDPPAQOCSVKGA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| InChIKey | VIDPPAQOCSVKGA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NN2)SCC(=O)O |
Computed by PubChem (NCBI)