cas: 7512-17-6 — see every product listed under this CAS number, including other names
2-ACETAMIDO-2-DEOXY-D-GLUCOSE, 97%, 97% (CAS 7512-17-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 5kg, 10kg, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149FR-5g |
| cas | 7512-17-6 |
| size | 5g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 93.20 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 500g | 312.00 Pln | |
| Chemat | 5kg | 2088.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 1kg | 534.80 Pln | |
| Chemat | 25kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Aldehydo-N-acetyl-D-glucosamine is the open-chain form of N-acetyl-D-glucosamine. It has a role as a human metabolite.
Source: ChEBI
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| InChIKey | MBLBDJOUHNCFQT-LXGUWJNJSA-N |
| SMILES | CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)