cas: 7512-17-6 — see every product listed under this CAS number, including other names
N-Acetyl-D-glucosamine, 98.00% (CAS 7512-17-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250g, 25g, 500g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM79870C-100g |
| cas | 7512-17-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 422.22 Pln | |
| Chemat | 250g | 695.47 Pln | |
| Chemat | 25g | 192.54 Pln | |
| Chemat | 500g | 1093.99 Pln | |
| Chemat | 5g | 118.53 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
Aldehydo-N-acetyl-D-glucosamine is the open-chain form of N-acetyl-D-glucosamine. It has a role as a human metabolite.
Source: ChEBI
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| InChIKey | MBLBDJOUHNCFQT-LXGUWJNJSA-N |
| SMILES | CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)