cas: 7512-17-6 — see every product listed under this CAS number, including other names
N-Acetyl-D-glucosamine, >98.0%(HPLC)(N) (CAS 7512-17-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0092-25G |
| cas | 7512-17-6 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 113.43 Pln | |
| TCI | 100g | 256.03 Pln | |
| TCI | 500g | 772.34 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(N) |
Aldehydo-N-acetyl-D-glucosamine is the open-chain form of N-acetyl-D-glucosamine. It has a role as a human metabolite.
Source: ChEBI
| Molecular formula | C8H15NO6 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | N-[(2R,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| InChIKey | MBLBDJOUHNCFQT-LXGUWJNJSA-N |
| SMILES | CC(=O)N[C@@H](C=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)