cas: 773109-32-3 — see every product listed under this CAS number, including other names
2-AMINO-3-CHLORO-5-NITROBENZOIC ACID, 95%, 95% (CAS 773109-32-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147HC-100mg |
| cas | 773109-32-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 506.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-3-chloro-5-nitrobenzoic acid (CAS 773109-32-3) is a chemical compound with the molecular formula C7H5ClN2O4 and a molecular weight of 216.58 g/mol. IUPAC name: 2-amino-3-chloro-5-nitrobenzoic acid. InChIKey: KHXIPGBFCRIAME-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O4 |
|---|---|
| Molecular weight | 216.58 g/mol |
| IUPAC name | 2-amino-3-chloro-5-nitrobenzoic acid |
| InChIKey | KHXIPGBFCRIAME-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)