cas: 1363380-49-7 — see every product listed under this CAS number, including other names
2-AMINO-5-BOC-5-AZA-SPIRO[3.4]OCTANE, 98% (CAS 1363380-49-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467855-25MG |
| cas | 1363380-49-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 1096.51 Pln | |
| Fluorochem | 100mg | 2955.23 Pln | |
| Fluorochem | 500mg | 7443.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-amino-5-azaspiro[3.4]octane-5-carboxylate (CAS 1363380-49-7) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 2-amino-5-azaspiro[3.4]octane-5-carboxylate. InChIKey: HKJVUMPWNMAHSI-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 2-amino-5-azaspiro[3.4]octane-5-carboxylate |
| InChIKey | HKJVUMPWNMAHSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CC(C2)N |
Computed by PubChem (NCBI)