CAS 646055-63-2 appears in our catalog under these names: 1,7-Diaza-spiro[4.4]nonane-7-carboxylic acid tert-butyl ester, 95%, 1,7-Diazaspiro(4.4)nonane-7-carboxylic acid tert-butyl ester, 7-Boc-1,7-diaza-spiro[4.4]nonane 98%, 7-Boc-1,7-Diaza-spiro[4.4]nonane, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 2g, 1g, 5g, 500mg, 10g.
Tert-butyl 1,7-diazaspiro[4.4]nonane-7-carboxylate (CAS 646055-63-2) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,7-diazaspiro[4.4]nonane-7-carboxylate. InChIKey: JMCDKYJLNLUCRX-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 1,7-diazaspiro[4.4]nonane-7-carboxylate |
| InChIKey | JMCDKYJLNLUCRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CCCN2 |
Computed by PubChem (NCBI)