Products 646055-63-2

CAS 646055-63-2 appears in our catalog under these names: 1,7-Diaza-spiro[4.4]nonane-7-carboxylic acid tert-butyl ester, 95%, 1,7-Diazaspiro(4.4)nonane-7-carboxylic acid tert-butyl ester, 7-Boc-1,7-diaza-spiro[4.4]nonane 98%, 7-Boc-1,7-Diaza-spiro[4.4]nonane, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 2g, 1g, 5g, 500mg, 10g.

Structural formula: {0} (CAS {1})

Tert-butyl 1,7-diazaspiro[4.4]nonane-7-carboxylate (CAS 646055-63-2) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 1,7-diazaspiro[4.4]nonane-7-carboxylate. InChIKey: JMCDKYJLNLUCRX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O2
Molecular weight226.32 g/mol
IUPAC nametert-butyl 1,7-diazaspiro[4.4]nonane-7-carboxylate
InChIKeyJMCDKYJLNLUCRX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(C1)CCCN2

Computed by PubChem (NCBI)