cas: 38985-79-4 — see every product listed under this CAS number, including other names
2-Acetamido-5-bromobenzoic acid, 97% (CAS 38985-79-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F620396-250MG |
| cas | 38985-79-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 268.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-acetamido-5-bromobenzoic acid (CAS 38985-79-4) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 2-acetamido-5-bromobenzoic acid. InChIKey: QVABAFHRLMDDLM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 2-acetamido-5-bromobenzoic acid |
| InChIKey | QVABAFHRLMDDLM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)