Products 912760-98-6

CAS 912760-98-6 is the registry number for 3-(5-Bromo-2-methoxy-pyridin-3-yl)-acrylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

(E)-3-(5-bromo-2-methoxy-3-pyridinyl)prop-2-enoic acid (CAS 912760-98-6) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: (E)-3-(5-bromo-2-methoxy-3-pyridinyl)prop-2-enoic acid. InChIKey: AJOCJTKIVWCVMY-NSCUHMNNSA-N.

Identity
Molecular formulaC9H8BrNO3
Molecular weight258.07 g/mol
IUPAC name(E)-3-(5-bromo-2-methoxy-3-pyridinyl)prop-2-enoic acid
InChIKeyAJOCJTKIVWCVMY-NSCUHMNNSA-N
SMILESCOC1=C(C=C(C=N1)Br)/C=C/C(=O)O

Computed by PubChem (NCBI)