CAS 38985-79-4 appears in our catalog under these names: 2-Acetamido-5-bromobenzoic acid, 98%, 2–Acetamido–5–bromobenzoic Acid, 2-Acetamido-5-bromobenzoic Acid, 2-Acetamido-5-bromobenzoic Acid, >98.0%(GC)(T), 2-Acetamido-5-bromobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 2,5g, 0,25g, 10g, 250mg.
2-acetamido-5-bromobenzoic acid (CAS 38985-79-4) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 2-acetamido-5-bromobenzoic acid. InChIKey: QVABAFHRLMDDLM-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 2-acetamido-5-bromobenzoic acid |
| InChIKey | QVABAFHRLMDDLM-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)