CAS 943995-18-4 appears in our catalog under these names: 6-Bromo-8-methoxy-2h-benzo[b][1,4]oxazin-3(4h)-one, 97%, 6–Bromo–8–methoxy–2H–benzo(b)(1,4)oxazin–3(4H)–one, 6-Bromo-8-methoxy-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%, 98%, 6-BROMO-8-METHOXY-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100mg.
6-bromo-8-methoxy-4H-1,4-benzoxazin-3-one (CAS 943995-18-4) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 6-bromo-8-methoxy-4H-1,4-benzoxazin-3-one. InChIKey: MIXOICKBNDQVQQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 6-bromo-8-methoxy-4H-1,4-benzoxazin-3-one |
| InChIKey | MIXOICKBNDQVQQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1OCC(=O)N2)Br |
Computed by PubChem (NCBI)