CAS 57728-60-6 appears in our catalog under these names: [(3-bromophenyl)formamido]acetic acid, 95%, 2-((3-bromophenyl)formamido)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g.
2-[(3-bromobenzoyl)amino]acetic acid (CAS 57728-60-6) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 2-[(3-bromobenzoyl)amino]acetic acid. InChIKey: SPMZGXLKQBBVKH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 2-[(3-bromobenzoyl)amino]acetic acid |
| InChIKey | SPMZGXLKQBBVKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)