cas: 3900-45-6 — see every product listed under this CAS number, including other names
2-Acetyl-6-methoxynaphthalene, 95% (CAS 3900-45-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077909-25G |
| cas | 3900-45-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 143.72 Pln | |
| Fluorochem | 500g | 393.63 Pln | |
| Fluorochem | 1kg | 627.92 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(6-methoxynaphthalen-2-yl)ethanone (CAS 3900-45-6) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 1-(6-methoxynaphthalen-2-yl)ethanone. InChIKey: GGWCZBGAIGGTDA-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-(6-methoxynaphthalen-2-yl)ethanone |
| InChIKey | GGWCZBGAIGGTDA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)