CAS 72824-05-6 appears in our catalog under these names: Propen-1-ylboronic acid, pinacol ester, 98%, 4,4,5,5-Tetramethyl-2-(prop-1-en-1-yl)-1,3,2-dioxaborolane, ≥95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane (CAS 72824-05-6) is a chemical compound with the molecular formula C9H17BO2 and a molecular weight of 168.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane. InChIKey: COPMASWDWLENMV-VOTSOKGWSA-N.
| Molecular formula | C9H17BO2 |
|---|---|
| Molecular weight | 168.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | COPMASWDWLENMV-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C |
Computed by PubChem (NCBI)