CAS 126689-01-8 appears in our catalog under these names: Cyclopropylboronic acid pinacol ester, Cyclopropylboronic acid pinacol ester, 96% , 2-Cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95.0%(GC), Cyclopropylboronic acid pinacol ester, 95%, Cyclopropylboronic acid pinacol ester, 97% . Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Thermo Scientific. Available pack sizes: 25g, 1g, 5g, 10g, 100g.
2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 126689-01-8) is a chemical compound with the molecular formula C9H17BO2 and a molecular weight of 168.04 g/mol. IUPAC name: 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XGBMQBPLWXTEPM-UHFFFAOYSA-N.
| Molecular formula | C9H17BO2 |
|---|---|
| Molecular weight | 168.04 g/mol |
| IUPAC name | 2-cyclopropyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XGBMQBPLWXTEPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CC2 |
Computed by PubChem (NCBI)