CAS 83947-59-5 appears in our catalog under these names: cis-1-Propenylboronic Acid Pinacol Ester, (Z)-4,4,5,5-Tetramethyl-2-(prop-1-en-1-yl)-1,3,2-dioxaborolane 95%, 4,4,5,5-Tetramethyl-2-(1Z)-1-propen-1-yl-1,3,2-dioxaborolane, 95%, 95%, (Z)-4,4,5,5-Tetramethyl-2-(prop-1-en-1-yl)-1,3,2-dioxaborolane, 95%(stabilized with TBC). Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
4,4,5,5-tetramethyl-2-[(Z)-prop-1-enyl]-1,3,2-dioxaborolane (CAS 83947-59-5) is a chemical compound with the molecular formula C9H17BO2 and a molecular weight of 168.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(Z)-prop-1-enyl]-1,3,2-dioxaborolane. InChIKey: COPMASWDWLENMV-SREVYHEPSA-N.
| Molecular formula | C9H17BO2 |
|---|---|
| Molecular weight | 168.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(Z)-prop-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | COPMASWDWLENMV-SREVYHEPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\C |
Computed by PubChem (NCBI)