CAS 83947-58-4 appears in our catalog under these names: (E)-4,4,5,5-Tetramethyl-2-(prop-1-en-1-yl)-1,3,2-dioxaborolane, 98% +(stabilized with Phenothiazine), (E)-1-Propenylboronic Pinacol Ester, 4,4,5,5–Tetramethyl–2–((E)–propenyl)(1,3,2)dioxaborolane, (E)-4,4,5,5-Tetramethyl-2-(prop-1-en-1-yl)-1,3,2-dioxaborolane 95% (stabilized with Phenothiazine), TRANS-1-PROPENYLBORONIC ACID PINACOL ES&. Offered by: AmBeed, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 5g, 100mg, 1g, 2,5g, 50mg, 250mg.
4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane (CAS 83947-58-4) is a chemical compound with the molecular formula C9H17BO2 and a molecular weight of 168.04 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane. InChIKey: COPMASWDWLENMV-VOTSOKGWSA-N.
| Molecular formula | C9H17BO2 |
|---|---|
| Molecular weight | 168.04 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-prop-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | COPMASWDWLENMV-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C |
Computed by PubChem (NCBI)