CAS 1240557-01-0 appears in our catalog under these names: 2–Amino–(1,1'–biphenyl)–4,4'–dicarboxylic acid, 2-Amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%, 97%, 2-Amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 95%, 2-Amino-[1,1'-biphenyl]-4,4'-dicarboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 15g, 100mg, 10g, 25g, 100g.
3-amino-4-(4-carboxyphenyl)benzoic acid (CAS 1240557-01-0) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 3-amino-4-(4-carboxyphenyl)benzoic acid. InChIKey: FYEKGZUXGKAJJQ-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 3-amino-4-(4-carboxyphenyl)benzoic acid |
| InChIKey | FYEKGZUXGKAJJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)