cas: 372143-98-1 — see every product listed under this CAS number, including other names
2-Amino-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid hydrochloride (CAS 372143-98-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447323-250MG |
| cas | 372143-98-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1913.93 Pln |
| delivery time | 3-4 weeks |
|---|
2-amino-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride (CAS 372143-98-1) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 2-amino-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride. InChIKey: DLLMYOUDVHEYSC-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 2-amino-3,4-dihydro-1H-naphthalene-2-carboxylic acid;hydrochloride |
| InChIKey | DLLMYOUDVHEYSC-UHFFFAOYSA-N |
| SMILES | C1CC(CC2=CC=CC=C21)(C(=O)O)N.Cl |
Computed by PubChem (NCBI)