cas: 254762-66-8 — see every product listed under this CAS number, including other names
2-Amino-2-(2-bromophenyl)acetic acid, 98%, 98% (CAS 254762-66-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCN6-250mg |
| cas | 254762-66-8 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 952.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-2-(2-bromophenyl)acetic acid (CAS 254762-66-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-2-(2-bromophenyl)acetic acid. InChIKey: PTWAPNNQAOAJDI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-2-(2-bromophenyl)acetic acid |
| InChIKey | PTWAPNNQAOAJDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)Br |
Computed by PubChem (NCBI)