cas: 254762-66-8 — see every product listed under this CAS number, including other names
H-DL-2-Phg(2-Br)-Oh 98% (CAS 254762-66-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A959772-250mg |
| cas | 254762-66-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 403.75 Pln | |
| Ambeed | 5g | 1232.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A959772 |
2-amino-2-(2-bromophenyl)acetic acid (CAS 254762-66-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-2-(2-bromophenyl)acetic acid. InChIKey: PTWAPNNQAOAJDI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-2-(2-bromophenyl)acetic acid |
| InChIKey | PTWAPNNQAOAJDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)Br |
Computed by PubChem (NCBI)