CAS 254762-66-8 appears in our catalog under these names: 2-Amino-2-(2-bromophenyl)acetic acid, 98%, 2–Amino–2–(2–bromophenyl)acetic acid, H-DL-2-Phg(2-Br)-Oh 98%, 2-Amino-2-(2-bromophenyl)acetic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
2-amino-2-(2-bromophenyl)acetic acid (CAS 254762-66-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-2-(2-bromophenyl)acetic acid. InChIKey: PTWAPNNQAOAJDI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-2-(2-bromophenyl)acetic acid |
| InChIKey | PTWAPNNQAOAJDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)N)Br |
Computed by PubChem (NCBI)